C22H25N3O3 — CID 166255803
methyl 3-[1-(1-cyanocyclopentanecarbonyl)piperidin-4-yl]-1H-indole-5-carboxylate (PubChem CID 166255803) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is methyl 3-[1-(1-cyanocyclopentanecarbonyl)piperidin-4-yl]-1H-indole-5-carboxylate.
| Compound Name | methyl 3-[1-(1-cyanocyclopentanecarbonyl)piperidin-4-yl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 166255803 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | methyl 3-[1-(1-cyanocyclopentanecarbonyl)piperidin-4-yl]-1H-indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]cc(C3CCN(C(=O)C4(C#N)CCCC4)CC3)c2c1 |
| InChI | InChI=1S/C22H25N3O3/c1-28-20(26)16-4-5-19-17(12-16)18(13-24-19)15-6-10-25(11-7-15)21(27)22(14-23)8-2-3-9-22/h4-5,12-13,15,24H,2-3,6-11H2,1H3 |
| InChIKey | ZVADOOJWTKCQDZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |