C25H28N4O5 — CID 166273079
methyl 3-[1-[2-[(5-ethoxy-6-methyl-2-pyridinyl)amino]-2-oxoacetyl]piperidin-4-yl]-1H-indole-5-carboxylate (PubChem CID 166273079) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is methyl 3-[1-[2-[(5-ethoxy-6-methyl-2-pyridinyl)amino]-2-oxoacetyl]piperidin-4-yl]-1H-indole-5-carboxylate.
| Compound Name | methyl 3-[1-[2-[(5-ethoxy-6-methyl-2-pyridinyl)amino]-2-oxoacetyl]piperidin-4-yl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 166273079 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | methyl 3-[1-[2-[(5-ethoxy-6-methyl-2-pyridinyl)amino]-2-oxoacetyl]piperidin-4-yl]-1H-indole-5-carboxylate |
| SMILES | CCOc1ccc(NC(=O)C(=O)N2CCC(c3c[nH]c4ccc(C(=O)OC)cc34)CC2)nc1C |
| InChI | InChI=1S/C25H28N4O5/c1-4-34-21-7-8-22(27-15(21)2)28-23(30)24(31)29-11-9-16(10-12-29)19-14-26-20-6-5-17(13-18(19)20)25(32)33-3/h5-8,13-14,16,26H,4,9-12H2,1-3H3,(H,27,28,30) |
| InChIKey | GORFJDHWNBBODR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|