C23H24FNO3 — CID 16626302
(3-fluorophenyl)-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone (PubChem CID 16626302) has the molecular formula C23H24FNO3 and a molecular weight of 381.45 g/mol. Its IUPAC name is (3-fluorophenyl)-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone.
| Compound Name | (3-fluorophenyl)-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone |
|---|---|
| PubChem CID | 16626302 |
| Molecular Formula | C23H24FNO3 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (3-fluorophenyl)-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone |
| SMILES | CC1c2cc3c(cc2C2(CCCC2)CN1C(=O)c1cccc(F)c1)OCCO3 |
| InChI | InChI=1S/C23H24FNO3/c1-15-18-12-20-21(28-10-9-27-20)13-19(18)23(7-2-3-8-23)14-25(15)22(26)16-5-4-6-17(24)11-16/h4-6,11-13,15H,2-3,7-10,14H2,1H3 |
| InChIKey | PMPMBZXKWRVRHW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |