C15H14ClN5O2 — CID 166263129
(5-chloro-1H-indol-2-yl)-[3-hydroxy-3-(3-methyltriazol-4-yl)azetidin-1-yl]methanone (PubChem CID 166263129) has the molecular formula C15H14ClN5O2 and a molecular weight of 331.76 g/mol. Its IUPAC name is (5-chloro-1H-indol-2-yl)-[3-hydroxy-3-(3-methyltriazol-4-yl)azetidin-1-yl]methanone.
| Compound Name | (5-chloro-1H-indol-2-yl)-[3-hydroxy-3-(3-methyltriazol-4-yl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 166263129 |
| Molecular Formula | C15H14ClN5O2 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (5-chloro-1H-indol-2-yl)-[3-hydroxy-3-(3-methyltriazol-4-yl)azetidin-1-yl]methanone |
| SMILES | Cn1nncc1C1(O)CN(C(=O)c2cc3cc(Cl)ccc3[nH]2)C1 |
| InChI | InChI=1S/C15H14ClN5O2/c1-20-13(6-17-19-20)15(23)7-21(8-15)14(22)12-5-9-4-10(16)2-3-11(9)18-12/h2-6,18,23H,7-8H2,1H3 |
| InChIKey | AVMHQLXAUWICQJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |