C20H30N2O3S — CID 166265620
2-[(3aR,6aS)-3a,6a-bis(hydroxymethyl)-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]-N-(3-phenylsulfanylpropyl)acetamide (PubChem CID 166265620) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is 2-[(3aR,6aS)-3a,6a-bis(hydroxymethyl)-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]-N-(3-phenylsulfanylpropyl)acetamide.
| Compound Name | 2-[(3aR,6aS)-3a,6a-bis(hydroxymethyl)-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]-N-(3-phenylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 166265620 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 2-[(3aR,6aS)-3a,6a-bis(hydroxymethyl)-3,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]-N-(3-phenylsulfanylpropyl)acetamide |
| SMILES | O=C(CN1C[C@]2(CO)CCC[C@]2(CO)C1)NCCCSc1ccccc1 |
| InChI | InChI=1S/C20H30N2O3S/c23-15-19-8-4-9-20(19,16-24)14-22(13-19)12-18(25)21-10-5-11-26-17-6-2-1-3-7-17/h1-3,6-7,23-24H,4-5,8-16H2,(H,21,25)/t19-,20+ |
| InChIKey | QBOXDSVIYRRIQT-BGYRXZFFSA-N |
| XLogP | 1.74 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|