C13H15N3O3S2 — CID 166268815
N-[(3-cyanophenyl)sulfamoyl]-2-methylthiolane-2-carboxamide (PubChem CID 166268815) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is N-[(3-cyanophenyl)sulfamoyl]-2-methylthiolane-2-carboxamide.
| Compound Name | N-[(3-cyanophenyl)sulfamoyl]-2-methylthiolane-2-carboxamide |
|---|---|
| PubChem CID | 166268815 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-[(3-cyanophenyl)sulfamoyl]-2-methylthiolane-2-carboxamide |
| SMILES | CC1(C(=O)NS(=O)(=O)Nc2cccc(C#N)c2)CCCS1 |
| InChI | InChI=1S/C13H15N3O3S2/c1-13(6-3-7-20-13)12(17)16-21(18,19)15-11-5-2-4-10(8-11)9-14/h2,4-5,8,15H,3,6-7H2,1H3,(H,16,17) |
| InChIKey | GOBGFCUFUITNIL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |