C16H20N2OS — CID 81452415
N-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]-2-methylthiolane-2-carboxamide (PubChem CID 81452415) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is N-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]-2-methylthiolane-2-carboxamide.
| Compound Name | N-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]-2-methylthiolane-2-carboxamide |
|---|---|
| PubChem CID | 81452415 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]-2-methylthiolane-2-carboxamide |
| SMILES | CC1(C(=O)NCc2cccc(C#CCN)c2)CCCS1 |
| InChI | InChI=1S/C16H20N2OS/c1-16(8-4-10-20-16)15(19)18-12-14-6-2-5-13(11-14)7-3-9-17/h2,5-6,11H,4,8-10,12,17H2,1H3,(H,18,19) |
| InChIKey | DCROQFRUKPIMBZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|