C15H14N4O — CID 102922464
N-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]pyrimidine-5-carboxamide (PubChem CID 102922464) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]pyrimidine-5-carboxamide.
| Compound Name | N-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 102922464 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-[[3-(3-aminoprop-1-ynyl)phenyl]methyl]pyrimidine-5-carboxamide |
| SMILES | NCC#Cc1cccc(CNC(=O)c2cncnc2)c1 |
| InChI | InChI=1S/C15H14N4O/c16-6-2-5-12-3-1-4-13(7-12)8-19-15(20)14-9-17-11-18-10-14/h1,3-4,7,9-11H,6,8,16H2,(H,19,20) |
| InChIKey | YSEPTWZMZFTGBB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|