C16H17N5 — CID 166271173
7-(2-phenylpiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 166271173) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 7-(2-phenylpiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-(2-phenylpiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 166271173 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 7-(2-phenylpiperidin-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | c1ccc(C2CCCCN2c2ccnc3ncnn23)cc1 |
| InChI | InChI=1S/C16H17N5/c1-2-6-13(7-3-1)14-8-4-5-11-20(14)15-9-10-17-16-18-12-19-21(15)16/h1-3,6-7,9-10,12,14H,4-5,8,11H2 |
| InChIKey | HQKSQZIYTQFFFC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |