C22H33NO3 — CID 16627119
(10R,13S,17R)-17-hydroxy-3,3-dimethoxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 16627119) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is (10R,13S,17R)-17-hydroxy-3,3-dimethoxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (10R,13S,17R)-17-hydroxy-3,3-dimethoxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 16627119 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (10R,13S,17R)-17-hydroxy-3,3-dimethoxy-10,13-dimethyl-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | COC1(OC)CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@]2(O)C#N)C1 |
| InChI | InChI=1S/C22H33NO3/c1-19-11-12-22(25-3,26-4)13-15(19)5-6-16-17(19)7-9-20(2)18(16)8-10-21(20,24)14-23/h5,16-18,24H,6-13H2,1-4H3/t16?,17?,18?,19-,20-,21-/m0/s1 |
| InChIKey | LXRARGUENMWWRO-AYUYWISESA-N |
| XLogP | 4.19 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|