About N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide
N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide (PubChem CID 166272639) has the molecular formula C10H13Cl2NO3S2
and a molecular weight of 330.26 g/mol. Its IUPAC name is N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide |
| PubChem CID | 166272639 |
| Molecular Formula | C10H13Cl2NO3S2 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide |
| SMILES | COc1sccc1S(=O)(=O)NCCC1CC1(Cl)Cl |
| InChI | InChI=1S/C10H13Cl2NO3S2/c1-16-9-8(3-5-17-9)18(14,15)13-4-2-7-6-10(7,11)12/h3,5,7,13H,2,4,6H2,1H3 |
| InChIKey | RPJDDAMBQVWDGX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide?
The IUPAC name of N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide (CID 166272639) is N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide.
What is the SMILES notation for N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide?
The canonical SMILES for N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide is COc1sccc1S(=O)(=O)NCCC1CC1(Cl)Cl.
What is the InChIKey of N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide?
The InChIKey is RPJDDAMBQVWDGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl2NO3S2/c1-16-9-8(3-5-17-9)18(14,15)13-4-2-7-6-10(7,11)12/h3,5,7,13H,2,4,6H2,1H3.
What are the key properties of N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide?
N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide has a molecular weight of 330.26 g/mol, XLogP of 2.62, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide is sourced from PubChem (CID 166272639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).