C10H13Cl2NO3S2 — CID 166272639
N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide (PubChem CID 166272639) has the molecular formula C10H13Cl2NO3S2 and a molecular weight of 330.26 g/mol. Its IUPAC name is N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide.
| Compound Name | N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide |
|---|---|
| PubChem CID | 166272639 |
| Molecular Formula | C10H13Cl2NO3S2 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | N-[2-(2,2-dichlorocyclopropyl)ethyl]-2-methoxythiophene-3-sulfonamide |
| SMILES | COc1sccc1S(=O)(=O)NCCC1CC1(Cl)Cl |
| InChI | InChI=1S/C10H13Cl2NO3S2/c1-16-9-8(3-5-17-9)18(14,15)13-4-2-7-6-10(7,11)12/h3,5,7,13H,2,4,6H2,1H3 |
| InChIKey | RPJDDAMBQVWDGX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|