C16H20N2O6S2 — CID 71093006
[3-[[2-methoxy-4-(propan-2-ylamino)phenyl]sulfamoyl]thiophen-2-yl] methyl carbonate (PubChem CID 71093006) has the molecular formula C16H20N2O6S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is [3-[[2-methoxy-4-(propan-2-ylamino)phenyl]sulfamoyl]thiophen-2-yl] methyl carbonate.
| Compound Name | [3-[[2-methoxy-4-(propan-2-ylamino)phenyl]sulfamoyl]thiophen-2-yl] methyl carbonate |
|---|---|
| PubChem CID | 71093006 |
| Molecular Formula | C16H20N2O6S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | [3-[[2-methoxy-4-(propan-2-ylamino)phenyl]sulfamoyl]thiophen-2-yl] methyl carbonate |
| SMILES | COC(=O)Oc1sccc1S(=O)(=O)Nc1ccc(NC(C)C)cc1OC |
| InChI | InChI=1S/C16H20N2O6S2/c1-10(2)17-11-5-6-12(13(9-11)22-3)18-26(20,21)14-7-8-25-15(14)24-16(19)23-4/h5-10,17-18H,1-4H3 |
| InChIKey | KYHHKQFRYWTFCE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |