C13H13ClKNO4 — CID 166275493
potassium 1-[[2-(3-chlorophenyl)acetyl]amino]-3-hydroxycyclobutane-1-carboxylate (PubChem CID 166275493) has the molecular formula C13H13ClKNO4 and a molecular weight of 321.80 g/mol. Its IUPAC name is potassium 1-[[2-(3-chlorophenyl)acetyl]amino]-3-hydroxycyclobutane-1-carboxylate.
| Compound Name | potassium 1-[[2-(3-chlorophenyl)acetyl]amino]-3-hydroxycyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 166275493 |
| Molecular Formula | C13H13ClKNO4 |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | potassium 1-[[2-(3-chlorophenyl)acetyl]amino]-3-hydroxycyclobutane-1-carboxylate |
| SMILES | O=C(Cc1cccc(Cl)c1)NC1(C(=O)[O-])CC(O)C1.[K+] |
| InChI | InChI=1S/C13H14ClNO4.K/c14-9-3-1-2-8(4-9)5-11(17)15-13(12(18)19)6-10(16)7-13;/h1-4,10,16H,5-7H2,(H,15,17)(H,18,19);/q;+1/p-1 |
| InChIKey | PJCNROCVJOEAIC-UHFFFAOYSA-M |
| XLogP | -3.35 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |