C18H17Cl2NO — CID 166211233
2-(3-chlorophenyl)-N-[2-(2-chlorophenyl)-2-methylcyclopropyl]acetamide (PubChem CID 166211233) has the molecular formula C18H17Cl2NO and a molecular weight of 334.25 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[2-(2-chlorophenyl)-2-methylcyclopropyl]acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-[2-(2-chlorophenyl)-2-methylcyclopropyl]acetamide |
|---|---|
| PubChem CID | 166211233 |
| Molecular Formula | C18H17Cl2NO |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[2-(2-chlorophenyl)-2-methylcyclopropyl]acetamide |
| SMILES | CC1(c2ccccc2Cl)CC1NC(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2NO/c1-18(14-7-2-3-8-15(14)20)11-16(18)21-17(22)10-12-5-4-6-13(19)9-12/h2-9,16H,10-11H2,1H3,(H,21,22) |
| InChIKey | RLEMDOAMWMIOCQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |