C17H18F2N2O2 — CID 166278244
N-(4,4-difluorocyclohexyl)-8-hydroxy-N-methylquinoline-7-carboxamide (PubChem CID 166278244) has the molecular formula C17H18F2N2O2 and a molecular weight of 320.34 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-8-hydroxy-N-methylquinoline-7-carboxamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-8-hydroxy-N-methylquinoline-7-carboxamide |
|---|---|
| PubChem CID | 166278244 |
| Molecular Formula | C17H18F2N2O2 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-8-hydroxy-N-methylquinoline-7-carboxamide |
| SMILES | CN(C(=O)c1ccc2cccnc2c1O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C17H18F2N2O2/c1-21(12-6-8-17(18,19)9-7-12)16(23)13-5-4-11-3-2-10-20-14(11)15(13)22/h2-5,10,12,22H,6-9H2,1H3 |
| InChIKey | ONWLTKYIGTVKRK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |