C15H18N6O — CID 166281005
1-(4-cyclobutylpyrimidin-2-yl)-3-(5-cyclopropyl-1H-pyrazol-4-yl)urea (PubChem CID 166281005) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-(4-cyclobutylpyrimidin-2-yl)-3-(5-cyclopropyl-1H-pyrazol-4-yl)urea.
| Compound Name | 1-(4-cyclobutylpyrimidin-2-yl)-3-(5-cyclopropyl-1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 166281005 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-(4-cyclobutylpyrimidin-2-yl)-3-(5-cyclopropyl-1H-pyrazol-4-yl)urea |
| SMILES | O=C(Nc1nccc(C2CCC2)n1)Nc1cn[nH]c1C1CC1 |
| InChI | InChI=1S/C15H18N6O/c22-15(19-12-8-17-21-13(12)10-4-5-10)20-14-16-7-6-11(18-14)9-2-1-3-9/h6-10H,1-5H2,(H,17,21)(H2,16,18,19,20,22) |
| InChIKey | AEVADHZGFKVPPF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |