About 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea
1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea (PubChem CID 167913870) has the molecular formula C15H14N6O
and a molecular weight of 294.32 g/mol. Its IUPAC name is 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea.
Molecular Properties
| Compound Name | 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea |
| PubChem CID | 167913870 |
| Molecular Formula | C15H14N6O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea |
| SMILES | O=C(Nc1ccc2ncccc2n1)Nc1cn[nH]c1C1CC1 |
| InChI | InChI=1S/C15H14N6O/c22-15(19-12-8-17-21-14(12)9-3-4-9)20-13-6-5-10-11(18-13)2-1-7-16-10/h1-2,5-9H,3-4H2,(H,17,21)(H2,18,19,20,22) |
| InChIKey | DCJREIBDEWPIAL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea?
The IUPAC name of 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea (CID 167913870) is 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea.
What is the SMILES notation for 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea?
The canonical SMILES for 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea is O=C(Nc1ccc2ncccc2n1)Nc1cn[nH]c1C1CC1.
What is the InChIKey of 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea?
The InChIKey is DCJREIBDEWPIAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N6O/c22-15(19-12-8-17-21-14(12)9-3-4-9)20-13-6-5-10-11(18-13)2-1-7-16-10/h1-2,5-9H,3-4H2,(H,17,21)(H2,18,19,20,22).
What are the key properties of 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea?
1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea has a molecular weight of 294.32 g/mol, XLogP of 2.87, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(1,5-naphthyridin-2-yl)urea is sourced from PubChem (CID 167913870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).