C15H23ClN2O4S — CID 166282143
3-(2-chlorophenyl)-1-(2,3-dimethoxypropylsulfonyl)piperazine (PubChem CID 166282143) has the molecular formula C15H23ClN2O4S and a molecular weight of 362.88 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-(2,3-dimethoxypropylsulfonyl)piperazine.
| Compound Name | 3-(2-chlorophenyl)-1-(2,3-dimethoxypropylsulfonyl)piperazine |
|---|---|
| PubChem CID | 166282143 |
| Molecular Formula | C15H23ClN2O4S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 3-(2-chlorophenyl)-1-(2,3-dimethoxypropylsulfonyl)piperazine |
| SMILES | COCC(CS(=O)(=O)N1CCNC(c2ccccc2Cl)C1)OC |
| InChI | InChI=1S/C15H23ClN2O4S/c1-21-10-12(22-2)11-23(19,20)18-8-7-17-15(9-18)13-5-3-4-6-14(13)16/h3-6,12,15,17H,7-11H2,1-2H3 |
| InChIKey | AJETWNWAEGYKPH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |