C21H26ClN5O — CID 154755976
[3-(2-chlorophenyl)piperazin-1-yl]-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methanone (PubChem CID 154755976) has the molecular formula C21H26ClN5O and a molecular weight of 399.93 g/mol. Its IUPAC name is [3-(2-chlorophenyl)piperazin-1-yl]-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methanone.
| Compound Name | [3-(2-chlorophenyl)piperazin-1-yl]-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 154755976 |
| Molecular Formula | C21H26ClN5O |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [3-(2-chlorophenyl)piperazin-1-yl]-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methanone |
| SMILES | CN1CCN(c2cc(C(=O)N3CCNC(c4ccccc4Cl)C3)ccn2)CC1 |
| InChI | InChI=1S/C21H26ClN5O/c1-25-10-12-26(13-11-25)20-14-16(6-7-24-20)21(28)27-9-8-23-19(15-27)17-4-2-3-5-18(17)22/h2-7,14,19,23H,8-13,15H2,1H3 |
| InChIKey | ABMSHILQWLAQJS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |