C15H21N3O2 — CID 166283493
5-pyridin-3-yl-3-(2,4,4-trimethylpentyl)-1,3,4-oxadiazol-2-one (PubChem CID 166283493) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 5-pyridin-3-yl-3-(2,4,4-trimethylpentyl)-1,3,4-oxadiazol-2-one.
| Compound Name | 5-pyridin-3-yl-3-(2,4,4-trimethylpentyl)-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 166283493 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 5-pyridin-3-yl-3-(2,4,4-trimethylpentyl)-1,3,4-oxadiazol-2-one |
| SMILES | CC(Cn1nc(-c2cccnc2)oc1=O)CC(C)(C)C |
| InChI | InChI=1S/C15H21N3O2/c1-11(8-15(2,3)4)10-18-14(19)20-13(17-18)12-6-5-7-16-9-12/h5-7,9,11H,8,10H2,1-4H3 |
| InChIKey | PDZUWUMLQBWEFH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |