C19H20N4O3 — CID 166285787
1-[[3-(1,3-dioxolan-2-yl)phenyl]methyl]-3-(1H-indazol-6-ylmethyl)urea (PubChem CID 166285787) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-[[3-(1,3-dioxolan-2-yl)phenyl]methyl]-3-(1H-indazol-6-ylmethyl)urea.
| Compound Name | 1-[[3-(1,3-dioxolan-2-yl)phenyl]methyl]-3-(1H-indazol-6-ylmethyl)urea |
|---|---|
| PubChem CID | 166285787 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[[3-(1,3-dioxolan-2-yl)phenyl]methyl]-3-(1H-indazol-6-ylmethyl)urea |
| SMILES | O=C(NCc1cccc(C2OCCO2)c1)NCc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C19H20N4O3/c24-19(21-11-14-4-5-16-12-22-23-17(16)9-14)20-10-13-2-1-3-15(8-13)18-25-6-7-26-18/h1-5,8-9,12,18H,6-7,10-11H2,(H,22,23)(H2,20,21,24) |
| InChIKey | HKLJYTYANUDGGQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |