C19H17F3N2O3 — CID 166286433
4-amino-N-[4-[3-(trifluoromethyl)phenoxy]phenyl]-2-oxabicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 166286433) has the molecular formula C19H17F3N2O3 and a molecular weight of 378.35 g/mol. Its IUPAC name is 4-amino-N-[4-[3-(trifluoromethyl)phenoxy]phenyl]-2-oxabicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | 4-amino-N-[4-[3-(trifluoromethyl)phenoxy]phenyl]-2-oxabicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 166286433 |
| Molecular Formula | C19H17F3N2O3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 4-amino-N-[4-[3-(trifluoromethyl)phenoxy]phenyl]-2-oxabicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | NC12COC(C(=O)Nc3ccc(Oc4cccc(C(F)(F)F)c4)cc3)(C1)C2 |
| InChI | InChI=1S/C19H17F3N2O3/c20-19(21,22)12-2-1-3-15(8-12)27-14-6-4-13(5-7-14)24-16(25)18-9-17(23,10-18)11-26-18/h1-8H,9-11,23H2,(H,24,25) |
| InChIKey | VKJQTJHAVXGBFY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |