C17H17Cl2N3O2 — CID 166287454
N-[cyano-(2,3-dichlorophenyl)methyl]-1-prop-2-enoylpiperidine-3-carboxamide (PubChem CID 166287454) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is N-[cyano-(2,3-dichlorophenyl)methyl]-1-prop-2-enoylpiperidine-3-carboxamide.
| Compound Name | N-[cyano-(2,3-dichlorophenyl)methyl]-1-prop-2-enoylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 166287454 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[cyano-(2,3-dichlorophenyl)methyl]-1-prop-2-enoylpiperidine-3-carboxamide |
| SMILES | C=CC(=O)N1CCCC(C(=O)NC(C#N)c2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-2-15(23)22-8-4-5-11(10-22)17(24)21-14(9-20)12-6-3-7-13(18)16(12)19/h2-3,6-7,11,14H,1,4-5,8,10H2,(H,21,24) |
| InChIKey | IDYLPJPZNVTWAH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|