C16H22N2O4S — CID 166287715
2-[(2S)-1-[cyclopentyl(methyl)sulfamoyl]-2,3-dihydroindol-2-yl]acetic acid (PubChem CID 166287715) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-[(2S)-1-[cyclopentyl(methyl)sulfamoyl]-2,3-dihydroindol-2-yl]acetic acid.
| Compound Name | 2-[(2S)-1-[cyclopentyl(methyl)sulfamoyl]-2,3-dihydroindol-2-yl]acetic acid |
|---|---|
| PubChem CID | 166287715 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-[(2S)-1-[cyclopentyl(methyl)sulfamoyl]-2,3-dihydroindol-2-yl]acetic acid |
| SMILES | CN(C1CCCC1)S(=O)(=O)N1c2ccccc2C[C@H]1CC(=O)O |
| InChI | InChI=1S/C16H22N2O4S/c1-17(13-7-3-4-8-13)23(21,22)18-14(11-16(19)20)10-12-6-2-5-9-15(12)18/h2,5-6,9,13-14H,3-4,7-8,10-11H2,1H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | UEJXZKVRDLNPMH-AWEZNQCLSA-N |
| XLogP | 2.01 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |