C11H15N3O4S — CID 166288029
1-(2-ethylpyrazol-3-yl)sulfonyl-3,6-dihydro-2H-pyridine-3-carboxylic acid (PubChem CID 166288029) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is 1-(2-ethylpyrazol-3-yl)sulfonyl-3,6-dihydro-2H-pyridine-3-carboxylic acid.
| Compound Name | 1-(2-ethylpyrazol-3-yl)sulfonyl-3,6-dihydro-2H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 166288029 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 1-(2-ethylpyrazol-3-yl)sulfonyl-3,6-dihydro-2H-pyridine-3-carboxylic acid |
| SMILES | CCn1nccc1S(=O)(=O)N1CC=CC(C(=O)O)C1 |
| InChI | InChI=1S/C11H15N3O4S/c1-2-14-10(5-6-12-14)19(17,18)13-7-3-4-9(8-13)11(15)16/h3-6,9H,2,7-8H2,1H3,(H,15,16) |
| InChIKey | YGILGLPOAQDPRJ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|