C16H23NO5S — CID 166289237
1-(3-ethoxyphenyl)sulfonyl-2,2-dimethylpiperidine-4-carboxylic acid (PubChem CID 166289237) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)sulfonyl-2,2-dimethylpiperidine-4-carboxylic acid.
| Compound Name | 1-(3-ethoxyphenyl)sulfonyl-2,2-dimethylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 166289237 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-(3-ethoxyphenyl)sulfonyl-2,2-dimethylpiperidine-4-carboxylic acid |
| SMILES | CCOc1cccc(S(=O)(=O)N2CCC(C(=O)O)CC2(C)C)c1 |
| InChI | InChI=1S/C16H23NO5S/c1-4-22-13-6-5-7-14(10-13)23(20,21)17-9-8-12(15(18)19)11-16(17,2)3/h5-7,10,12H,4,8-9,11H2,1-3H3,(H,18,19) |
| InChIKey | NSPIZCLWRCYJDN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |