C17H20N2O4 — CID 166290460
4-[bis(prop-2-enyl)carbamoyl]-3,5-dihydro-2H-1,4-benzoxazepine-9-carboxylic acid (PubChem CID 166290460) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)carbamoyl]-3,5-dihydro-2H-1,4-benzoxazepine-9-carboxylic acid.
| Compound Name | 4-[bis(prop-2-enyl)carbamoyl]-3,5-dihydro-2H-1,4-benzoxazepine-9-carboxylic acid |
|---|---|
| PubChem CID | 166290460 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-[bis(prop-2-enyl)carbamoyl]-3,5-dihydro-2H-1,4-benzoxazepine-9-carboxylic acid |
| SMILES | C=CCN(CC=C)C(=O)N1CCOc2c(cccc2C(=O)O)C1 |
| InChI | InChI=1S/C17H20N2O4/c1-3-8-18(9-4-2)17(22)19-10-11-23-15-13(12-19)6-5-7-14(15)16(20)21/h3-7H,1-2,8-12H2,(H,20,21) |
| InChIKey | BRUHSNLSLNJCOP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|