C18H17N3O2 — CID 166292626
N-(2-oxo-1,3-dihydroindol-5-yl)-1-pyridin-3-ylcyclobutane-1-carboxamide (PubChem CID 166292626) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-(2-oxo-1,3-dihydroindol-5-yl)-1-pyridin-3-ylcyclobutane-1-carboxamide.
| Compound Name | N-(2-oxo-1,3-dihydroindol-5-yl)-1-pyridin-3-ylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 166292626 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-(2-oxo-1,3-dihydroindol-5-yl)-1-pyridin-3-ylcyclobutane-1-carboxamide |
| SMILES | O=C1Cc2cc(NC(=O)C3(c4cccnc4)CCC3)ccc2N1 |
| InChI | InChI=1S/C18H17N3O2/c22-16-10-12-9-14(4-5-15(12)21-16)20-17(23)18(6-2-7-18)13-3-1-8-19-11-13/h1,3-5,8-9,11H,2,6-7,10H2,(H,20,23)(H,21,22) |
| InChIKey | KBCHXEDDXSXACL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |