C21H24N2O3 — CID 166293210
N-[(3-hydroxycyclopentyl)methyl]-N'-(3-methyl-5-phenylphenyl)oxamide (PubChem CID 166293210) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[(3-hydroxycyclopentyl)methyl]-N'-(3-methyl-5-phenylphenyl)oxamide.
| Compound Name | N-[(3-hydroxycyclopentyl)methyl]-N'-(3-methyl-5-phenylphenyl)oxamide |
|---|---|
| PubChem CID | 166293210 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[(3-hydroxycyclopentyl)methyl]-N'-(3-methyl-5-phenylphenyl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NCC2CCC(O)C2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-14-9-17(16-5-3-2-4-6-16)12-18(10-14)23-21(26)20(25)22-13-15-7-8-19(24)11-15/h2-6,9-10,12,15,19,24H,7-8,11,13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | HFMJAWHJFFWGNS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|