C13H13F2NO4S — CID 166293319
1-[(2,4-difluorophenyl)methylsulfonyl]-3,6-dihydro-2H-pyridine-3-carboxylic acid (PubChem CID 166293319) has the molecular formula C13H13F2NO4S and a molecular weight of 317.31 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methylsulfonyl]-3,6-dihydro-2H-pyridine-3-carboxylic acid.
| Compound Name | 1-[(2,4-difluorophenyl)methylsulfonyl]-3,6-dihydro-2H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 166293319 |
| Molecular Formula | C13H13F2NO4S |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methylsulfonyl]-3,6-dihydro-2H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)C1C=CCN(S(=O)(=O)Cc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C13H13F2NO4S/c14-11-4-3-10(12(15)6-11)8-21(19,20)16-5-1-2-9(7-16)13(17)18/h1-4,6,9H,5,7-8H2,(H,17,18) |
| InChIKey | ZYCLZVFZNZIFRE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|