C12H13ClN4O2 — CID 166293497
N-[2-(4-chloro-2-methylphenoxy)ethyl]-2H-triazole-4-carboxamide (PubChem CID 166293497) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.72 g/mol. Its IUPAC name is N-[2-(4-chloro-2-methylphenoxy)ethyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[2-(4-chloro-2-methylphenoxy)ethyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 166293497 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-[2-(4-chloro-2-methylphenoxy)ethyl]-2H-triazole-4-carboxamide |
| SMILES | Cc1cc(Cl)ccc1OCCNC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C12H13ClN4O2/c1-8-6-9(13)2-3-11(8)19-5-4-14-12(18)10-7-15-17-16-10/h2-3,6-7H,4-5H2,1H3,(H,14,18)(H,15,16,17) |
| InChIKey | QWYPSBBMKCDAGR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|