C10H12N6O2S — CID 166294565
4-methyl-3-[1-(2-sulfanylidene-1,3-dihydroimidazole-4-carbonyl)azetidin-3-yl]-1H-1,2,4-triazol-5-one (PubChem CID 166294565) has the molecular formula C10H12N6O2S and a molecular weight of 280.31 g/mol. Its IUPAC name is 4-methyl-3-[1-(2-sulfanylidene-1,3-dihydroimidazole-4-carbonyl)azetidin-3-yl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-methyl-3-[1-(2-sulfanylidene-1,3-dihydroimidazole-4-carbonyl)azetidin-3-yl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 166294565 |
| Molecular Formula | C10H12N6O2S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-methyl-3-[1-(2-sulfanylidene-1,3-dihydroimidazole-4-carbonyl)azetidin-3-yl]-1H-1,2,4-triazol-5-one |
| SMILES | Cn1c(C2CN(C(=O)c3c[nH]c(=S)[nH]3)C2)n[nH]c1=O |
| InChI | InChI=1S/C10H12N6O2S/c1-15-7(13-14-10(15)18)5-3-16(4-5)8(17)6-2-11-9(19)12-6/h2,5H,3-4H2,1H3,(H,14,18)(H2,11,12,19) |
| InChIKey | YLQDLLJYDBYEPH-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|