C20H22N2O5 — CID 166295844
2-benzyl-3-[[4-(1,3-dioxolan-2-yl)pyridine-3-carbonyl]amino]butanoic acid (PubChem CID 166295844) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-benzyl-3-[[4-(1,3-dioxolan-2-yl)pyridine-3-carbonyl]amino]butanoic acid.
| Compound Name | 2-benzyl-3-[[4-(1,3-dioxolan-2-yl)pyridine-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 166295844 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-benzyl-3-[[4-(1,3-dioxolan-2-yl)pyridine-3-carbonyl]amino]butanoic acid |
| SMILES | CC(NC(=O)c1cnccc1C1OCCO1)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H22N2O5/c1-13(16(19(24)25)11-14-5-3-2-4-6-14)22-18(23)17-12-21-8-7-15(17)20-26-9-10-27-20/h2-8,12-13,16,20H,9-11H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | HYVNSNXHPAJIPW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |