C17H23N3O4 — CID 166296354
methyl N-[1-(4-cyclopentyloxypyridine-2-carbonyl)pyrrolidin-3-yl]carbamate (PubChem CID 166296354) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is methyl N-[1-(4-cyclopentyloxypyridine-2-carbonyl)pyrrolidin-3-yl]carbamate.
| Compound Name | methyl N-[1-(4-cyclopentyloxypyridine-2-carbonyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 166296354 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | methyl N-[1-(4-cyclopentyloxypyridine-2-carbonyl)pyrrolidin-3-yl]carbamate |
| SMILES | COC(=O)NC1CCN(C(=O)c2cc(OC3CCCC3)ccn2)C1 |
| InChI | InChI=1S/C17H23N3O4/c1-23-17(22)19-12-7-9-20(11-12)16(21)15-10-14(6-8-18-15)24-13-4-2-3-5-13/h6,8,10,12-13H,2-5,7,9,11H2,1H3,(H,19,22) |
| InChIKey | MWDOTOMTBSQHDM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |