C17H21N3O2 — CID 166300928
1-ethyl-N-(3-phenyloxan-3-yl)pyrazole-3-carboxamide (PubChem CID 166300928) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-ethyl-N-(3-phenyloxan-3-yl)pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N-(3-phenyloxan-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166300928 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-ethyl-N-(3-phenyloxan-3-yl)pyrazole-3-carboxamide |
| SMILES | CCn1ccc(C(=O)NC2(c3ccccc3)CCCOC2)n1 |
| InChI | InChI=1S/C17H21N3O2/c1-2-20-11-9-15(19-20)16(21)18-17(10-6-12-22-13-17)14-7-4-3-5-8-14/h3-5,7-9,11H,2,6,10,12-13H2,1H3,(H,18,21) |
| InChIKey | ZJQOZRKVFQESHR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |