C14H23N3O2 — CID 146043892
1-ethyl-N-[(1S,2S)-2-hydroxycyclooctyl]pyrazole-3-carboxamide (PubChem CID 146043892) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-ethyl-N-[(1S,2S)-2-hydroxycyclooctyl]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N-[(1S,2S)-2-hydroxycyclooctyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146043892 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1-ethyl-N-[(1S,2S)-2-hydroxycyclooctyl]pyrazole-3-carboxamide |
| SMILES | CCn1ccc(C(=O)N[C@H]2CCCCCC[C@@H]2O)n1 |
| InChI | InChI=1S/C14H23N3O2/c1-2-17-10-9-12(16-17)14(19)15-11-7-5-3-4-6-8-13(11)18/h9-11,13,18H,2-8H2,1H3,(H,15,19)/t11-,13-/m0/s1 |
| InChIKey | PLHVKGMEIGKHKQ-AAEUAGOBSA-N |
| XLogP | 1.72 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |