C14H17F3N4O3 — CID 166301052
N-[2-[3-cyano-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]-2-oxoethyl]-N-ethylprop-2-enamide (PubChem CID 166301052) has the molecular formula C14H17F3N4O3 and a molecular weight of 346.31 g/mol. Its IUPAC name is N-[2-[3-cyano-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]-2-oxoethyl]-N-ethylprop-2-enamide.
| Compound Name | N-[2-[3-cyano-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]-2-oxoethyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 166301052 |
| Molecular Formula | C14H17F3N4O3 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N-[2-[3-cyano-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]-2-oxoethyl]-N-ethylprop-2-enamide |
| SMILES | C=CC(=O)N(CC)CC(=O)N1CCC(C#N)(NC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H17F3N4O3/c1-3-10(22)20(4-2)7-11(23)21-6-5-13(8-18,9-21)19-12(24)14(15,16)17/h3H,1,4-7,9H2,2H3,(H,19,24) |
| InChIKey | PSGGABXANMAFFP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|