C13H18F3N3O3 — CID 166407460
N-methyl-N-[2-[3-methyl-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]-2-oxoethyl]prop-2-enamide (PubChem CID 166407460) has the molecular formula C13H18F3N3O3 and a molecular weight of 321.30 g/mol. Its IUPAC name is N-methyl-N-[2-[3-methyl-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]-2-oxoethyl]prop-2-enamide.
| Compound Name | N-methyl-N-[2-[3-methyl-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166407460 |
| Molecular Formula | C13H18F3N3O3 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-methyl-N-[2-[3-methyl-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]-2-oxoethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)CC(=O)N1CCC(C)(NC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C13H18F3N3O3/c1-4-9(20)18(3)7-10(21)19-6-5-12(2,8-19)17-11(22)13(14,15)16/h4H,1,5-8H2,2-3H3,(H,17,22) |
| InChIKey | IVJSHJUFHRLFOJ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|