C13H21F2N3O2 — CID 167747277
N-[2-[[1-(2,2-difluoroethyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-N-ethylprop-2-enamide (PubChem CID 167747277) has the molecular formula C13H21F2N3O2 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[2-[[1-(2,2-difluoroethyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-N-ethylprop-2-enamide.
| Compound Name | N-[2-[[1-(2,2-difluoroethyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 167747277 |
| Molecular Formula | C13H21F2N3O2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N-[2-[[1-(2,2-difluoroethyl)pyrrolidin-3-yl]amino]-2-oxoethyl]-N-ethylprop-2-enamide |
| SMILES | C=CC(=O)N(CC)CC(=O)NC1CCN(CC(F)F)C1 |
| InChI | InChI=1S/C13H21F2N3O2/c1-3-13(20)18(4-2)9-12(19)16-10-5-6-17(7-10)8-11(14)15/h3,10-11H,1,4-9H2,2H3,(H,16,19) |
| InChIKey | SQOBRIIVBDLCPO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|