C11H15F3N2O2 — CID 166411558
N-[2-[(3S,4S)-3-methyl-4-(trifluoromethyl)pyrrolidin-1-yl]-2-oxoethyl]prop-2-enamide (PubChem CID 166411558) has the molecular formula C11H15F3N2O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is N-[2-[(3S,4S)-3-methyl-4-(trifluoromethyl)pyrrolidin-1-yl]-2-oxoethyl]prop-2-enamide.
| Compound Name | N-[2-[(3S,4S)-3-methyl-4-(trifluoromethyl)pyrrolidin-1-yl]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166411558 |
| Molecular Formula | C11H15F3N2O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-[2-[(3S,4S)-3-methyl-4-(trifluoromethyl)pyrrolidin-1-yl]-2-oxoethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(=O)N1C[C@@H](C)[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C11H15F3N2O2/c1-3-9(17)15-4-10(18)16-5-7(2)8(6-16)11(12,13)14/h3,7-8H,1,4-6H2,2H3,(H,15,17)/t7-,8-/m1/s1 |
| InChIKey | MWFBXNOIECRILM-HTQZYQBOSA-N |
| XLogP | 0.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|