C8H11F3N2O — CID 176700945
1-[3-amino-3-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 176700945) has the molecular formula C8H11F3N2O and a molecular weight of 208.18 g/mol. Its IUPAC name is 1-[3-amino-3-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-amino-3-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176700945 |
| Molecular Formula | C8H11F3N2O |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 1-[3-amino-3-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(N)(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H11F3N2O/c1-2-6(14)13-4-3-7(12,5-13)8(9,10)11/h2H,1,3-5,12H2 |
| InChIKey | VROIVSTWMSLXQS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|