C9H14F2N2O — CID 167807269
N-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]prop-2-enamide (PubChem CID 167807269) has the molecular formula C9H14F2N2O and a molecular weight of 204.22 g/mol. Its IUPAC name is N-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 167807269 |
| Molecular Formula | C9H14F2N2O |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | N-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCN(CC(F)F)C1 |
| InChI | InChI=1S/C9H14F2N2O/c1-2-9(14)12-7-3-4-13(5-7)6-8(10)11/h2,7-8H,1,3-6H2,(H,12,14)/t7-/m0/s1 |
| InChIKey | TTYGRPPOQJGAEF-ZETCQYMHSA-N |
| XLogP | 0.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|