C11H15F3N2O2 — CID 166406794
N-methyl-N-[2-oxo-2-[[1-(2,2,2-trifluoroethyl)cyclopropyl]amino]ethyl]prop-2-enamide (PubChem CID 166406794) has the molecular formula C11H15F3N2O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-[[1-(2,2,2-trifluoroethyl)cyclopropyl]amino]ethyl]prop-2-enamide.
| Compound Name | N-methyl-N-[2-oxo-2-[[1-(2,2,2-trifluoroethyl)cyclopropyl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166406794 |
| Molecular Formula | C11H15F3N2O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-methyl-N-[2-oxo-2-[[1-(2,2,2-trifluoroethyl)cyclopropyl]amino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)CC(=O)NC1(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H15F3N2O2/c1-3-9(18)16(2)6-8(17)15-10(4-5-10)7-11(12,13)14/h3H,1,4-7H2,2H3,(H,15,17) |
| InChIKey | NCPBGXBQAIQLIU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|