C20H29N3O3 — CID 166301892
2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[1-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-3-yl]acetamide (PubChem CID 166301892) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[1-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-3-yl]acetamide.
| Compound Name | 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[1-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 166301892 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[1-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-3-yl]acetamide |
| SMILES | COc1cc(CN2CCC(NC(=O)C[C@H]3C=C[C@@H](N)C3)C2)cc(OC)c1 |
| InChI | InChI=1S/C20H29N3O3/c1-25-18-8-15(9-19(11-18)26-2)12-23-6-5-17(13-23)22-20(24)10-14-3-4-16(21)7-14/h3-4,8-9,11,14,16-17H,5-7,10,12-13,21H2,1-2H3,(H,22,24)/t14-,16+,17?/m0/s1 |
| InChIKey | AUUFALJMWVKDDH-NOYLFRNESA-N |
| XLogP | 1.69 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|