C17H27N3O3 — CID 119897168
4-amino-N-[1-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-3-yl]butanamide (PubChem CID 119897168) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-amino-N-[1-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-3-yl]butanamide.
| Compound Name | 4-amino-N-[1-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 119897168 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 4-amino-N-[1-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-3-yl]butanamide |
| SMILES | COc1cc(CN2CCC(NC(=O)CCCN)C2)cc(OC)c1 |
| InChI | InChI=1S/C17H27N3O3/c1-22-15-8-13(9-16(10-15)23-2)11-20-7-5-14(12-20)19-17(21)4-3-6-18/h8-10,14H,3-7,11-12,18H2,1-2H3,(H,19,21) |
| InChIKey | GPFQYEJJUNESQK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |