C22H37N5O3 — CID 110045313
2-[[butylamino-[[1-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110045313) has the molecular formula C22H37N5O3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-[[butylamino-[[1-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[butylamino-[[1-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110045313 |
| Molecular Formula | C22H37N5O3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | 2-[[butylamino-[[1-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-3-yl]amino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCCCN/C(=N\CC(=O)N(C)C)NC1CCN(Cc2cc(OC)cc(OC)c2)C1 |
| InChI | InChI=1S/C22H37N5O3/c1-6-7-9-23-22(24-14-21(28)26(2)3)25-18-8-10-27(16-18)15-17-11-19(29-4)13-20(12-17)30-5/h11-13,18H,6-10,14-16H2,1-5H3,(H2,23,24,25) |
| InChIKey | QIBFAAVAJDKSJT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|