C17H26N6O — CID 166302165
1-[2-[(4-aminocyclohexyl)amino]pyrimidin-4-yl]-3-(cyclopropylmethyl)imidazolidin-4-one (PubChem CID 166302165) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-[2-[(4-aminocyclohexyl)amino]pyrimidin-4-yl]-3-(cyclopropylmethyl)imidazolidin-4-one.
| Compound Name | 1-[2-[(4-aminocyclohexyl)amino]pyrimidin-4-yl]-3-(cyclopropylmethyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 166302165 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-[2-[(4-aminocyclohexyl)amino]pyrimidin-4-yl]-3-(cyclopropylmethyl)imidazolidin-4-one |
| SMILES | NC1CCC(Nc2nccc(N3CC(=O)N(CC4CC4)C3)n2)CC1 |
| InChI | InChI=1S/C17H26N6O/c18-13-3-5-14(6-4-13)20-17-19-8-7-15(21-17)22-10-16(24)23(11-22)9-12-1-2-12/h7-8,12-14H,1-6,9-11,18H2,(H,19,20,21) |
| InChIKey | ARIRVOIDWWOWNC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |