C16H17N3O2 — CID 166302472
2,4-dihydrochromeno[4,3-c]pyrazol-3-yl(piperidin-1-yl)methanone (PubChem CID 166302472) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2,4-dihydrochromeno[4,3-c]pyrazol-3-yl(piperidin-1-yl)methanone.
| Compound Name | 2,4-dihydrochromeno[4,3-c]pyrazol-3-yl(piperidin-1-yl)methanone |
|---|---|
| PubChem CID | 166302472 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2,4-dihydrochromeno[4,3-c]pyrazol-3-yl(piperidin-1-yl)methanone |
| SMILES | O=C(c1[nH]nc2c1COc1ccccc1-2)N1CCCCC1 |
| InChI | InChI=1S/C16H17N3O2/c20-16(19-8-4-1-5-9-19)15-12-10-21-13-7-3-2-6-11(13)14(12)17-18-15/h2-3,6-7H,1,4-5,8-10H2,(H,17,18) |
| InChIKey | CZDIGQWCDIPFFK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |