C20H19ClN2O2 — CID 166307470
(E)-3-(4-chlorophenyl)-1-spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-ylprop-2-en-1-one (PubChem CID 166307470) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-ylprop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 166307470 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-1'-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)N1CCC2(CC1)OCc1ccncc12 |
| InChI | InChI=1S/C20H19ClN2O2/c21-17-4-1-15(2-5-17)3-6-19(24)23-11-8-20(9-12-23)18-13-22-10-7-16(18)14-25-20/h1-7,10,13H,8-9,11-12,14H2/b6-3+ |
| InChIKey | KYJLESBRWCJQOP-ZZXKWVIFSA-N |
| XLogP | 3.80 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|