C16H25NO3S2 — CID 166308027
2,2-dimethyl-N-(3-phenylsulfanylpropyl)oxane-4-sulfonamide (PubChem CID 166308027) has the molecular formula C16H25NO3S2 and a molecular weight of 343.51 g/mol. Its IUPAC name is 2,2-dimethyl-N-(3-phenylsulfanylpropyl)oxane-4-sulfonamide.
| Compound Name | 2,2-dimethyl-N-(3-phenylsulfanylpropyl)oxane-4-sulfonamide |
|---|---|
| PubChem CID | 166308027 |
| Molecular Formula | C16H25NO3S2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2,2-dimethyl-N-(3-phenylsulfanylpropyl)oxane-4-sulfonamide |
| SMILES | CC1(C)CC(S(=O)(=O)NCCCSc2ccccc2)CCO1 |
| InChI | InChI=1S/C16H25NO3S2/c1-16(2)13-15(9-11-20-16)22(18,19)17-10-6-12-21-14-7-4-3-5-8-14/h3-5,7-8,15,17H,6,9-13H2,1-2H3 |
| InChIKey | YBRSONXEWVXYJL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|